C18H37N3O2 — CID 107250066
tert-butyl N-[1-[1-(1-ethylpiperidin-3-yl)ethylamino]-2-methylpropan-2-yl]carbamate (PubChem CID 107250066) has the molecular formula C18H37N3O2 and a molecular weight of 327.51 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(1-ethylpiperidin-3-yl)ethylamino]-2-methylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(1-ethylpiperidin-3-yl)ethylamino]-2-methylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 107250066 |
| Molecular Formula | C18H37N3O2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | tert-butyl N-[1-[1-(1-ethylpiperidin-3-yl)ethylamino]-2-methylpropan-2-yl]carbamate |
| SMILES | CCN1CCCC(C(C)NCC(C)(C)NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H37N3O2/c1-8-21-11-9-10-15(12-21)14(2)19-13-18(6,7)20-16(22)23-17(3,4)5/h14-15,19H,8-13H2,1-7H3,(H,20,22) |
| InChIKey | GTZPHRMHFSXZOJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |