C17H29N3O2S — CID 107251439
tert-butyl N-[[2-[(3-aminothiophen-2-yl)methylamino]cyclohexyl]methyl]carbamate (PubChem CID 107251439) has the molecular formula C17H29N3O2S and a molecular weight of 339.51 g/mol. Its IUPAC name is tert-butyl N-[[2-[(3-aminothiophen-2-yl)methylamino]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-[(3-aminothiophen-2-yl)methylamino]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 107251439 |
| Molecular Formula | C17H29N3O2S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | tert-butyl N-[[2-[(3-aminothiophen-2-yl)methylamino]cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCCC1NCc1sccc1N |
| InChI | InChI=1S/C17H29N3O2S/c1-17(2,3)22-16(21)20-10-12-6-4-5-7-14(12)19-11-15-13(18)8-9-23-15/h8-9,12,14,19H,4-7,10-11,18H2,1-3H3,(H,20,21) |
| InChIKey | GQINEJILVQXMIK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |