C17H24F2N2O2 — CID 107253306
tert-butyl N-[(E)-4-[[4-(difluoromethyl)phenyl]methylamino]but-2-enyl]carbamate (PubChem CID 107253306) has the molecular formula C17H24F2N2O2 and a molecular weight of 326.39 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[[4-(difluoromethyl)phenyl]methylamino]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[[4-(difluoromethyl)phenyl]methylamino]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 107253306 |
| Molecular Formula | C17H24F2N2O2 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | tert-butyl N-[(E)-4-[[4-(difluoromethyl)phenyl]methylamino]but-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C=C/CNCc1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C17H24F2N2O2/c1-17(2,3)23-16(22)21-11-5-4-10-20-12-13-6-8-14(9-7-13)15(18)19/h4-9,15,20H,10-12H2,1-3H3,(H,21,22)/b5-4+ |
| InChIKey | PTTCWRVCEOWIMB-SNAWJCMRSA-N |
| XLogP | 3.79 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|