C16H28N4O2 — CID 107299180
tert-butyl N-[(E)-4-[(1-propan-2-ylpyrazol-4-yl)methylamino]but-2-enyl]carbamate (PubChem CID 107299180) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[(1-propan-2-ylpyrazol-4-yl)methylamino]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[(1-propan-2-ylpyrazol-4-yl)methylamino]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 107299180 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | tert-butyl N-[(E)-4-[(1-propan-2-ylpyrazol-4-yl)methylamino]but-2-enyl]carbamate |
| SMILES | CC(C)n1cc(CNC/C=C/CNC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C16H28N4O2/c1-13(2)20-12-14(11-19-20)10-17-8-6-7-9-18-15(21)22-16(3,4)5/h6-7,11-13,17H,8-10H2,1-5H3,(H,18,21)/b7-6+ |
| InChIKey | OBTPMIGTAXTDCS-VOTSOKGWSA-N |
| XLogP | 2.63 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|