C8H14O2 — CID 10725449
(4S)-4-hydroxy-5,5-dimethylhex-1-en-3-one (PubChem CID 10725449) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (4S)-4-hydroxy-5,5-dimethylhex-1-en-3-one.
| Compound Name | (4S)-4-hydroxy-5,5-dimethylhex-1-en-3-one |
|---|---|
| PubChem CID | 10725449 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (4S)-4-hydroxy-5,5-dimethylhex-1-en-3-one |
| SMILES | C=CC(=O)[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C8H14O2/c1-5-6(9)7(10)8(2,3)4/h5,7,10H,1H2,2-4H3/t7-/m1/s1 |
| InChIKey | DKMZIJQOAXKIEL-SSDOTTSWSA-N |
| XLogP | 1.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|