C9H16O2 — CID 10855719
(4R)-4-hydroxy-5,5-dimethylhept-6-en-3-one (PubChem CID 10855719) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (4R)-4-hydroxy-5,5-dimethylhept-6-en-3-one.
| Compound Name | (4R)-4-hydroxy-5,5-dimethylhept-6-en-3-one |
|---|---|
| PubChem CID | 10855719 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (4R)-4-hydroxy-5,5-dimethylhept-6-en-3-one |
| SMILES | C=CC(C)(C)[C@@H](O)C(=O)CC |
| InChI | InChI=1S/C9H16O2/c1-5-7(10)8(11)9(3,4)6-2/h6,8,11H,2,5H2,1,3-4H3/t8-/m0/s1 |
| InChIKey | CMXSHIUXNBTICS-QMMMGPOBSA-N |
| XLogP | 1.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|