C11H20O2 — CID 134993138
(4R,5S)-5-ethenyl-4-hydroxy-5-methyloctan-3-one (PubChem CID 134993138) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (4R,5S)-5-ethenyl-4-hydroxy-5-methyloctan-3-one.
| Compound Name | (4R,5S)-5-ethenyl-4-hydroxy-5-methyloctan-3-one |
|---|---|
| PubChem CID | 134993138 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (4R,5S)-5-ethenyl-4-hydroxy-5-methyloctan-3-one |
| SMILES | C=C[C@](C)(CCC)[C@@H](O)C(=O)CC |
| InChI | InChI=1S/C11H20O2/c1-5-8-11(4,7-3)10(13)9(12)6-2/h7,10,13H,3,5-6,8H2,1-2,4H3/t10-,11+/m0/s1 |
| InChIKey | QHNVJWLBLXRMRV-WDEREUQCSA-N |
| XLogP | 2.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|