C10H18O2 — CID 102338999
(4R)-4-hydroxy-5,5-dimethyloct-7-en-2-one (PubChem CID 102338999) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (4R)-4-hydroxy-5,5-dimethyloct-7-en-2-one.
| Compound Name | (4R)-4-hydroxy-5,5-dimethyloct-7-en-2-one |
|---|---|
| PubChem CID | 102338999 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (4R)-4-hydroxy-5,5-dimethyloct-7-en-2-one |
| SMILES | C=CCC(C)(C)[C@H](O)CC(C)=O |
| InChI | InChI=1S/C10H18O2/c1-5-6-10(3,4)9(12)7-8(2)11/h5,9,12H,1,6-7H2,2-4H3/t9-/m1/s1 |
| InChIKey | BKVZYSHDEKCSPY-SECBINFHSA-N |
| XLogP | 1.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|