C10H18O3 — CID 134970964
(3S,5S)-5-ethyl-3,5-dihydroxyoct-7-en-4-one (PubChem CID 134970964) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (3S,5S)-5-ethyl-3,5-dihydroxyoct-7-en-4-one.
| Compound Name | (3S,5S)-5-ethyl-3,5-dihydroxyoct-7-en-4-one |
|---|---|
| PubChem CID | 134970964 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (3S,5S)-5-ethyl-3,5-dihydroxyoct-7-en-4-one |
| SMILES | C=CC[C@@](O)(CC)C(=O)[C@@H](O)CC |
| InChI | InChI=1S/C10H18O3/c1-4-7-10(13,6-3)9(12)8(11)5-2/h4,8,11,13H,1,5-7H2,2-3H3/t8-,10-/m0/s1 |
| InChIKey | UQXOCYRVLJIKPQ-WPRPVWTQSA-N |
| XLogP | 1.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|