C21H34N2O3 — CID 107254875
benzyl 2-[(5-methylheptan-3-ylamino)methyl]morpholine-4-carboxylate (PubChem CID 107254875) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is benzyl 2-[(5-methylheptan-3-ylamino)methyl]morpholine-4-carboxylate.
| Compound Name | benzyl 2-[(5-methylheptan-3-ylamino)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 107254875 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | benzyl 2-[(5-methylheptan-3-ylamino)methyl]morpholine-4-carboxylate |
| SMILES | CCC(C)CC(CC)NCC1CN(C(=O)OCc2ccccc2)CCO1 |
| InChI | InChI=1S/C21H34N2O3/c1-4-17(3)13-19(5-2)22-14-20-15-23(11-12-25-20)21(24)26-16-18-9-7-6-8-10-18/h6-10,17,19-20,22H,4-5,11-16H2,1-3H3 |
| InChIKey | GVIJBWZAJYIEJO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |