C19H30N2O6S — CID 124889486
benzyl (2S)-2-[[(2R)-2-ethyl-4-hydroxybutyl]sulfamoylmethyl]morpholine-4-carboxylate (PubChem CID 124889486) has the molecular formula C19H30N2O6S and a molecular weight of 414.52 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2R)-2-ethyl-4-hydroxybutyl]sulfamoylmethyl]morpholine-4-carboxylate.
| Compound Name | benzyl (2S)-2-[[(2R)-2-ethyl-4-hydroxybutyl]sulfamoylmethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 124889486 |
| Molecular Formula | C19H30N2O6S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | benzyl (2S)-2-[[(2R)-2-ethyl-4-hydroxybutyl]sulfamoylmethyl]morpholine-4-carboxylate |
| SMILES | CC[C@H](CCO)CNS(=O)(=O)C[C@@H]1CN(C(=O)OCc2ccccc2)CCO1 |
| InChI | InChI=1S/C19H30N2O6S/c1-2-16(8-10-22)12-20-28(24,25)15-18-13-21(9-11-26-18)19(23)27-14-17-6-4-3-5-7-17/h3-7,16,18,20,22H,2,8-15H2,1H3/t16-,18+/m1/s1 |
| InChIKey | YOHYPUVTFOLTKM-AEFFLSMTSA-N |
| XLogP | 1.35 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |