C18H21BrN2O3S — CID 107254903
benzyl 2-[[(3-bromothiophen-2-yl)methylamino]methyl]morpholine-4-carboxylate (PubChem CID 107254903) has the molecular formula C18H21BrN2O3S and a molecular weight of 425.35 g/mol. Its IUPAC name is benzyl 2-[[(3-bromothiophen-2-yl)methylamino]methyl]morpholine-4-carboxylate.
| Compound Name | benzyl 2-[[(3-bromothiophen-2-yl)methylamino]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 107254903 |
| Molecular Formula | C18H21BrN2O3S |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | benzyl 2-[[(3-bromothiophen-2-yl)methylamino]methyl]morpholine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCOC(CNCc2sccc2Br)C1 |
| InChI | InChI=1S/C18H21BrN2O3S/c19-16-6-9-25-17(16)11-20-10-15-12-21(7-8-23-15)18(22)24-13-14-4-2-1-3-5-14/h1-6,9,15,20H,7-8,10-13H2 |
| InChIKey | QUFFNAYYYLPXDH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |