C12H19BrN2OS — CID 78960579
N-[(3-bromothiophen-2-yl)methyl]-1-(4-ethylmorpholin-2-yl)methanamine (PubChem CID 78960579) has the molecular formula C12H19BrN2OS and a molecular weight of 319.27 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-1-(4-ethylmorpholin-2-yl)methanamine.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-1-(4-ethylmorpholin-2-yl)methanamine |
|---|---|
| PubChem CID | 78960579 |
| Molecular Formula | C12H19BrN2OS |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-1-(4-ethylmorpholin-2-yl)methanamine |
| SMILES | CCN1CCOC(CNCc2sccc2Br)C1 |
| InChI | InChI=1S/C12H19BrN2OS/c1-2-15-4-5-16-10(9-15)7-14-8-12-11(13)3-6-17-12/h3,6,10,14H,2,4-5,7-9H2,1H3 |
| InChIKey | OFZYIASEGQYXGF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |