C10H18N4OS — CID 115906891
1-(4-ethylmorpholin-2-yl)-N-(thiadiazol-4-ylmethyl)methanamine (PubChem CID 115906891) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is 1-(4-ethylmorpholin-2-yl)-N-(thiadiazol-4-ylmethyl)methanamine.
| Compound Name | 1-(4-ethylmorpholin-2-yl)-N-(thiadiazol-4-ylmethyl)methanamine |
|---|---|
| PubChem CID | 115906891 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(4-ethylmorpholin-2-yl)-N-(thiadiazol-4-ylmethyl)methanamine |
| SMILES | CCN1CCOC(CNCc2csnn2)C1 |
| InChI | InChI=1S/C10H18N4OS/c1-2-14-3-4-15-10(7-14)6-11-5-9-8-16-13-12-9/h8,10-11H,2-7H2,1H3 |
| InChIKey | CPTSLWUMRYXPKZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |