C17H31N3O3 — CID 107255663
tert-butyl N-[8-(piperidin-4-ylamino)-2-oxabicyclo[4.2.0]octan-7-yl]carbamate (PubChem CID 107255663) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl N-[8-(piperidin-4-ylamino)-2-oxabicyclo[4.2.0]octan-7-yl]carbamate.
| Compound Name | tert-butyl N-[8-(piperidin-4-ylamino)-2-oxabicyclo[4.2.0]octan-7-yl]carbamate |
|---|---|
| PubChem CID | 107255663 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | tert-butyl N-[8-(piperidin-4-ylamino)-2-oxabicyclo[4.2.0]octan-7-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C2CCCOC2C1NC1CCNCC1 |
| InChI | InChI=1S/C17H31N3O3/c1-17(2,3)23-16(21)20-13-12-5-4-10-22-15(12)14(13)19-11-6-8-18-9-7-11/h11-15,18-19H,4-10H2,1-3H3,(H,20,21) |
| InChIKey | PFAYEYCJVFNLRM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |