C17H30N2O3S — CID 107255682
tert-butyl N-[8-(thiolan-3-ylmethylamino)-2-oxabicyclo[4.2.0]octan-7-yl]carbamate (PubChem CID 107255682) has the molecular formula C17H30N2O3S and a molecular weight of 342.51 g/mol. Its IUPAC name is tert-butyl N-[8-(thiolan-3-ylmethylamino)-2-oxabicyclo[4.2.0]octan-7-yl]carbamate.
| Compound Name | tert-butyl N-[8-(thiolan-3-ylmethylamino)-2-oxabicyclo[4.2.0]octan-7-yl]carbamate |
|---|---|
| PubChem CID | 107255682 |
| Molecular Formula | C17H30N2O3S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | tert-butyl N-[8-(thiolan-3-ylmethylamino)-2-oxabicyclo[4.2.0]octan-7-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C2CCCOC2C1NCC1CCSC1 |
| InChI | InChI=1S/C17H30N2O3S/c1-17(2,3)22-16(20)19-13-12-5-4-7-21-15(12)14(13)18-9-11-6-8-23-10-11/h11-15,18H,4-10H2,1-3H3,(H,19,20) |
| InChIKey | HEHCUTRJICYEBA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |