C15H22N4O2S — CID 107256290
tert-butyl N-[1-methyl-4-[(thiophen-3-ylmethylamino)methyl]pyrazol-5-yl]carbamate (PubChem CID 107256290) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is tert-butyl N-[1-methyl-4-[(thiophen-3-ylmethylamino)methyl]pyrazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[1-methyl-4-[(thiophen-3-ylmethylamino)methyl]pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 107256290 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | tert-butyl N-[1-methyl-4-[(thiophen-3-ylmethylamino)methyl]pyrazol-5-yl]carbamate |
| SMILES | Cn1ncc(CNCc2ccsc2)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22N4O2S/c1-15(2,3)21-14(20)18-13-12(9-17-19(13)4)8-16-7-11-5-6-22-10-11/h5-6,9-10,16H,7-8H2,1-4H3,(H,18,20) |
| InChIKey | MUQAYNXTTPTQSH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |