C17H22N2O2S — CID 107239520
tert-butyl N-[4-[(thiophen-3-ylmethylamino)methyl]phenyl]carbamate (PubChem CID 107239520) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is tert-butyl N-[4-[(thiophen-3-ylmethylamino)methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(thiophen-3-ylmethylamino)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 107239520 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | tert-butyl N-[4-[(thiophen-3-ylmethylamino)methyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CNCc2ccsc2)cc1 |
| InChI | InChI=1S/C17H22N2O2S/c1-17(2,3)21-16(20)19-15-6-4-13(5-7-15)10-18-11-14-8-9-22-12-14/h4-9,12,18H,10-11H2,1-3H3,(H,19,20) |
| InChIKey | NWUAZMNVAJCMNY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |