C19H22BrClN2O2 — CID 114076676
tert-butyl N-[4-[[(4-bromo-3-chlorophenyl)methylamino]methyl]phenyl]carbamate (PubChem CID 114076676) has the molecular formula C19H22BrClN2O2 and a molecular weight of 425.75 g/mol. Its IUPAC name is tert-butyl N-[4-[[(4-bromo-3-chlorophenyl)methylamino]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(4-bromo-3-chlorophenyl)methylamino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 114076676 |
| Molecular Formula | C19H22BrClN2O2 |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | tert-butyl N-[4-[[(4-bromo-3-chlorophenyl)methylamino]methyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CNCc2ccc(Br)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H22BrClN2O2/c1-19(2,3)25-18(24)23-15-7-4-13(5-8-15)11-22-12-14-6-9-16(20)17(21)10-14/h4-10,22H,11-12H2,1-3H3,(H,23,24) |
| InChIKey | JYVXWEZRYVGTNS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |