C15H28F2N2O2 — CID 107257366
tert-butyl N-[3-(cycloheptylamino)-2,2-difluoropropyl]carbamate (PubChem CID 107257366) has the molecular formula C15H28F2N2O2 and a molecular weight of 306.40 g/mol. Its IUPAC name is tert-butyl N-[3-(cycloheptylamino)-2,2-difluoropropyl]carbamate.
| Compound Name | tert-butyl N-[3-(cycloheptylamino)-2,2-difluoropropyl]carbamate |
|---|---|
| PubChem CID | 107257366 |
| Molecular Formula | C15H28F2N2O2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | tert-butyl N-[3-(cycloheptylamino)-2,2-difluoropropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(F)(F)CNC1CCCCCC1 |
| InChI | InChI=1S/C15H28F2N2O2/c1-14(2,3)21-13(20)19-11-15(16,17)10-18-12-8-6-4-5-7-9-12/h12,18H,4-11H2,1-3H3,(H,19,20) |
| InChIKey | KSENGUHGKICRCV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |