C16H27F2N3O2 — CID 104955545
tert-butyl N-[2,2-difluoro-3-[(1-prop-2-ynylpiperidin-4-yl)amino]propyl]carbamate (PubChem CID 104955545) has the molecular formula C16H27F2N3O2 and a molecular weight of 331.41 g/mol. Its IUPAC name is tert-butyl N-[2,2-difluoro-3-[(1-prop-2-ynylpiperidin-4-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2,2-difluoro-3-[(1-prop-2-ynylpiperidin-4-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 104955545 |
| Molecular Formula | C16H27F2N3O2 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | tert-butyl N-[2,2-difluoro-3-[(1-prop-2-ynylpiperidin-4-yl)amino]propyl]carbamate |
| SMILES | C#CCN1CCC(NCC(F)(F)CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H27F2N3O2/c1-5-8-21-9-6-13(7-10-21)19-11-16(17,18)12-20-14(22)23-15(2,3)4/h1,13,19H,6-12H2,2-4H3,(H,20,22) |
| InChIKey | OQEHAUCZRNNNKR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|