C13H11Cl2FN2O — CID 107258702
1-N-(3,5-dichlorophenyl)-2-fluoro-5-methoxybenzene-1,4-diamine (PubChem CID 107258702) has the molecular formula C13H11Cl2FN2O and a molecular weight of 301.15 g/mol. Its IUPAC name is 1-N-(3,5-dichlorophenyl)-2-fluoro-5-methoxybenzene-1,4-diamine.
| Compound Name | 1-N-(3,5-dichlorophenyl)-2-fluoro-5-methoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 107258702 |
| Molecular Formula | C13H11Cl2FN2O |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 1-N-(3,5-dichlorophenyl)-2-fluoro-5-methoxybenzene-1,4-diamine |
| SMILES | COc1cc(Nc2cc(Cl)cc(Cl)c2)c(F)cc1N |
| InChI | InChI=1S/C13H11Cl2FN2O/c1-19-13-6-12(10(16)5-11(13)17)18-9-3-7(14)2-8(15)4-9/h2-6,18H,17H2,1H3 |
| InChIKey | LDUIKKMNAMDBNU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|