C15H17FN2O2 — CID 107258978
2-fluoro-5-methoxy-1-N-(4-methoxy-3-methylphenyl)benzene-1,4-diamine (PubChem CID 107258978) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-fluoro-5-methoxy-1-N-(4-methoxy-3-methylphenyl)benzene-1,4-diamine.
| Compound Name | 2-fluoro-5-methoxy-1-N-(4-methoxy-3-methylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 107258978 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-fluoro-5-methoxy-1-N-(4-methoxy-3-methylphenyl)benzene-1,4-diamine |
| SMILES | COc1ccc(Nc2cc(OC)c(N)cc2F)cc1C |
| InChI | InChI=1S/C15H17FN2O2/c1-9-6-10(4-5-14(9)19-2)18-13-8-15(20-3)12(17)7-11(13)16/h4-8,18H,17H2,1-3H3 |
| InChIKey | LATIPFFYXLTEAF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|