C14H21FN2O2 — CID 107259104
5-fluoro-2-methoxy-4-(2,2,6-trimethylmorpholin-4-yl)aniline (PubChem CID 107259104) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is 5-fluoro-2-methoxy-4-(2,2,6-trimethylmorpholin-4-yl)aniline.
| Compound Name | 5-fluoro-2-methoxy-4-(2,2,6-trimethylmorpholin-4-yl)aniline |
|---|---|
| PubChem CID | 107259104 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 5-fluoro-2-methoxy-4-(2,2,6-trimethylmorpholin-4-yl)aniline |
| SMILES | COc1cc(N2CC(C)OC(C)(C)C2)c(F)cc1N |
| InChI | InChI=1S/C14H21FN2O2/c1-9-7-17(8-14(2,3)19-9)12-6-13(18-4)11(16)5-10(12)15/h5-6,9H,7-8,16H2,1-4H3 |
| InChIKey | SNADCHWUFIKRFJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|