C14H19FN2O3 — CID 107259477
4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-5-fluoro-2-methoxyaniline (PubChem CID 107259477) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is 4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-5-fluoro-2-methoxyaniline.
| Compound Name | 4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-5-fluoro-2-methoxyaniline |
|---|---|
| PubChem CID | 107259477 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)-5-fluoro-2-methoxyaniline |
| SMILES | COc1cc(N2CCCC3(C2)OCCO3)c(F)cc1N |
| InChI | InChI=1S/C14H19FN2O3/c1-18-13-8-12(10(15)7-11(13)16)17-4-2-3-14(9-17)19-5-6-20-14/h7-8H,2-6,9,16H2,1H3 |
| InChIKey | GQIFHNICWYUPGC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|