C12H15BrF2N2O — CID 169490492
5-bromo-4-(3,3-difluoropiperidin-1-yl)-2-methoxyaniline (PubChem CID 169490492) has the molecular formula C12H15BrF2N2O and a molecular weight of 321.17 g/mol. Its IUPAC name is 5-bromo-4-(3,3-difluoropiperidin-1-yl)-2-methoxyaniline.
| Compound Name | 5-bromo-4-(3,3-difluoropiperidin-1-yl)-2-methoxyaniline |
|---|---|
| PubChem CID | 169490492 |
| Molecular Formula | C12H15BrF2N2O |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 5-bromo-4-(3,3-difluoropiperidin-1-yl)-2-methoxyaniline |
| SMILES | COc1cc(N2CCCC(F)(F)C2)c(Br)cc1N |
| InChI | InChI=1S/C12H15BrF2N2O/c1-18-11-6-10(8(13)5-9(11)16)17-4-2-3-12(14,15)7-17/h5-6H,2-4,7,16H2,1H3 |
| InChIKey | HETZOHHLAZDCEL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|