C20H20F2N4O2 — CID 68775324
2-(3,3-difluoropiperidin-1-yl)-5-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 68775324) has the molecular formula C20H20F2N4O2 and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-(3,3-difluoropiperidin-1-yl)-5-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2-(3,3-difluoropiperidin-1-yl)-5-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 68775324 |
| Molecular Formula | C20H20F2N4O2 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-(3,3-difluoropiperidin-1-yl)-5-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | COc1ccccc1-c1noc(-c2ccc(N3CCCC(F)(F)C3)c(N)c2)n1 |
| InChI | InChI=1S/C20H20F2N4O2/c1-27-17-6-3-2-5-14(17)18-24-19(28-25-18)13-7-8-16(15(23)11-13)26-10-4-9-20(21,22)12-26/h2-3,5-8,11H,4,9-10,12,23H2,1H3 |
| InChIKey | PUSPNPUHGKNNRG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|