C14H17FN2O5 — CID 133396344
9-(4-fluoro-5-methoxy-2-nitrophenyl)-1,4-dioxa-9-azaspiro[4.5]decane (PubChem CID 133396344) has the molecular formula C14H17FN2O5 and a molecular weight of 312.30 g/mol. Its IUPAC name is 9-(4-fluoro-5-methoxy-2-nitrophenyl)-1,4-dioxa-9-azaspiro[4.5]decane.
| Compound Name | 9-(4-fluoro-5-methoxy-2-nitrophenyl)-1,4-dioxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 133396344 |
| Molecular Formula | C14H17FN2O5 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 9-(4-fluoro-5-methoxy-2-nitrophenyl)-1,4-dioxa-9-azaspiro[4.5]decane |
| SMILES | COc1cc(N2CCCC3(C2)OCCO3)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C14H17FN2O5/c1-20-13-8-11(12(17(18)19)7-10(13)15)16-4-2-3-14(9-16)21-5-6-22-14/h7-8H,2-6,9H2,1H3 |
| InChIKey | DATFPMRORKWVCN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|