C13H14BrFN2O4 — CID 116736719
8-(5-bromo-4-fluoro-2-nitrophenyl)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 116736719) has the molecular formula C13H14BrFN2O4 and a molecular weight of 361.17 g/mol. Its IUPAC name is 8-(5-bromo-4-fluoro-2-nitrophenyl)-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-(5-bromo-4-fluoro-2-nitrophenyl)-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 116736719 |
| Molecular Formula | C13H14BrFN2O4 |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 8-(5-bromo-4-fluoro-2-nitrophenyl)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | O=[N+]([O-])c1cc(F)c(Br)cc1N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C13H14BrFN2O4/c14-9-7-11(12(17(18)19)8-10(9)15)16-3-1-13(2-4-16)20-5-6-21-13/h7-8H,1-6H2 |
| InChIKey | CCVUFDXVDMITNE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|