C16H17N3O4 — CID 172541286
5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-ethenyl-2-nitrobenzonitrile (PubChem CID 172541286) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is 5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-ethenyl-2-nitrobenzonitrile.
| Compound Name | 5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-ethenyl-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 172541286 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 5-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-4-ethenyl-2-nitrobenzonitrile |
| SMILES | C=Cc1cc([N+](=O)[O-])c(C#N)cc1N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C16H17N3O4/c1-2-12-9-15(19(20)21)13(11-17)10-14(12)18-5-3-16(4-6-18)22-7-8-23-16/h2,9-10H,1,3-8H2 |
| InChIKey | NHIUBLXOBBJFKQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 88.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|