C9H10N2S — CID 10726009
5-[(2-methylthiophen-3-yl)methyl]-1H-imidazole (PubChem CID 10726009) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 5-[(2-methylthiophen-3-yl)methyl]-1H-imidazole.
| Compound Name | 5-[(2-methylthiophen-3-yl)methyl]-1H-imidazole |
|---|---|
| PubChem CID | 10726009 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 5-[(2-methylthiophen-3-yl)methyl]-1H-imidazole |
| SMILES | Cc1sccc1Cc1cnc[nH]1 |
| InChI | InChI=1S/C9H10N2S/c1-7-8(2-3-12-7)4-9-5-10-6-11-9/h2-3,5-6H,4H2,1H3,(H,10,11) |
| InChIKey | YREPSLLZPDCHGU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |