C8H14N2O3 — CID 107261037
N-(3-amino-2-hydroxy-3-oxopropyl)pent-4-enamide (PubChem CID 107261037) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)pent-4-enamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)pent-4-enamide |
|---|---|
| PubChem CID | 107261037 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)pent-4-enamide |
| SMILES | C=CCCC(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C8H14N2O3/c1-2-3-4-7(12)10-5-6(11)8(9)13/h2,6,11H,1,3-5H2,(H2,9,13)(H,10,12) |
| InChIKey | WVMARESPCGOOFY-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|