C11H17NO2 — CID 107262082
N-[(1-hydroxycyclopentyl)methyl]-N-methylbut-2-ynamide (PubChem CID 107262082) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N-[(1-hydroxycyclopentyl)methyl]-N-methylbut-2-ynamide.
| Compound Name | N-[(1-hydroxycyclopentyl)methyl]-N-methylbut-2-ynamide |
|---|---|
| PubChem CID | 107262082 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-[(1-hydroxycyclopentyl)methyl]-N-methylbut-2-ynamide |
| SMILES | CC#CC(=O)N(C)CC1(O)CCCC1 |
| InChI | InChI=1S/C11H17NO2/c1-3-6-10(13)12(2)9-11(14)7-4-5-8-11/h14H,4-5,7-9H2,1-2H3 |
| InChIKey | BBTVZIVTMJKSQB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|