C10H14F5NO2 — CID 114037872
2,2,3,3,3-pentafluoro-N-[(1-hydroxycyclopentyl)methyl]-N-methylpropanamide (PubChem CID 114037872) has the molecular formula C10H14F5NO2 and a molecular weight of 275.22 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[(1-hydroxycyclopentyl)methyl]-N-methylpropanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[(1-hydroxycyclopentyl)methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 114037872 |
| Molecular Formula | C10H14F5NO2 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[(1-hydroxycyclopentyl)methyl]-N-methylpropanamide |
| SMILES | CN(CC1(O)CCCC1)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F5NO2/c1-16(6-8(18)4-2-3-5-8)7(17)9(11,12)10(13,14)15/h18H,2-6H2,1H3 |
| InChIKey | NFPWLGDGUKIAHL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|