C14H19BrO4S — CID 107262244
4-bromo-2-(3-butoxy-2-hydroxypropyl)sulfanylbenzoic acid (PubChem CID 107262244) has the molecular formula C14H19BrO4S and a molecular weight of 363.27 g/mol. Its IUPAC name is 4-bromo-2-(3-butoxy-2-hydroxypropyl)sulfanylbenzoic acid.
| Compound Name | 4-bromo-2-(3-butoxy-2-hydroxypropyl)sulfanylbenzoic acid |
|---|---|
| PubChem CID | 107262244 |
| Molecular Formula | C14H19BrO4S |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 4-bromo-2-(3-butoxy-2-hydroxypropyl)sulfanylbenzoic acid |
| SMILES | CCCCOCC(O)CSc1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C14H19BrO4S/c1-2-3-6-19-8-11(16)9-20-13-7-10(15)4-5-12(13)14(17)18/h4-5,7,11,16H,2-3,6,8-9H2,1H3,(H,17,18) |
| InChIKey | LEIVFRQSTMXHOY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|