C14H19BrO3 — CID 118101243
(2R)-2-(4-bromo-2-methylphenyl)-3-butoxypropanoic acid (PubChem CID 118101243) has the molecular formula C14H19BrO3 and a molecular weight of 315.21 g/mol. Its IUPAC name is (2R)-2-(4-bromo-2-methylphenyl)-3-butoxypropanoic acid.
| Compound Name | (2R)-2-(4-bromo-2-methylphenyl)-3-butoxypropanoic acid |
|---|---|
| PubChem CID | 118101243 |
| Molecular Formula | C14H19BrO3 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | (2R)-2-(4-bromo-2-methylphenyl)-3-butoxypropanoic acid |
| SMILES | CCCCOC[C@H](C(=O)O)c1ccc(Br)cc1C |
| InChI | InChI=1S/C14H19BrO3/c1-3-4-7-18-9-13(14(16)17)12-6-5-11(15)8-10(12)2/h5-6,8,13H,3-4,7,9H2,1-2H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | RZCFKBFAHORFDR-ZDUSSCGKSA-N |
| XLogP | 3.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|