C13H18BrNS — CID 107267553
1-(3-bromo-4-methylphenyl)-N-[(1-methylsulfanylcyclopropyl)methyl]methanamine (PubChem CID 107267553) has the molecular formula C13H18BrNS and a molecular weight of 300.27 g/mol. Its IUPAC name is 1-(3-bromo-4-methylphenyl)-N-[(1-methylsulfanylcyclopropyl)methyl]methanamine.
| Compound Name | 1-(3-bromo-4-methylphenyl)-N-[(1-methylsulfanylcyclopropyl)methyl]methanamine |
|---|---|
| PubChem CID | 107267553 |
| Molecular Formula | C13H18BrNS |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 1-(3-bromo-4-methylphenyl)-N-[(1-methylsulfanylcyclopropyl)methyl]methanamine |
| SMILES | CSC1(CNCc2ccc(C)c(Br)c2)CC1 |
| InChI | InChI=1S/C13H18BrNS/c1-10-3-4-11(7-12(10)14)8-15-9-13(16-2)5-6-13/h3-4,7,15H,5-6,8-9H2,1-2H3 |
| InChIKey | QLCIWYKFWFYPQH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |