C13H24N2O3 — CID 107268371
1-[4-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]piperidin-1-yl]ethanone (PubChem CID 107268371) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-[4-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 107268371 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-[4-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(NCC2(O)CCOC2C)CC1 |
| InChI | InChI=1S/C13H24N2O3/c1-10-13(17,5-8-18-10)9-14-12-3-6-15(7-4-12)11(2)16/h10,12,14,17H,3-9H2,1-2H3 |
| InChIKey | JAGLXQNXBUKOBT-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |