C11H14N4S — CID 107268789
5-[(1-methylsulfanylcyclobutyl)methylamino]pyrazine-2-carbonitrile (PubChem CID 107268789) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 5-[(1-methylsulfanylcyclobutyl)methylamino]pyrazine-2-carbonitrile.
| Compound Name | 5-[(1-methylsulfanylcyclobutyl)methylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 107268789 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-[(1-methylsulfanylcyclobutyl)methylamino]pyrazine-2-carbonitrile |
| SMILES | CSC1(CNc2cnc(C#N)cn2)CCC1 |
| InChI | InChI=1S/C11H14N4S/c1-16-11(3-2-4-11)8-15-10-7-13-9(5-12)6-14-10/h6-7H,2-4,8H2,1H3,(H,14,15) |
| InChIKey | IUIKVCLXXIXHDQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |