C10H14ClN3S — CID 107268817
6-chloro-N-[(1-methylsulfanylcyclobutyl)methyl]pyrazin-2-amine (PubChem CID 107268817) has the molecular formula C10H14ClN3S and a molecular weight of 243.76 g/mol. Its IUPAC name is 6-chloro-N-[(1-methylsulfanylcyclobutyl)methyl]pyrazin-2-amine.
| Compound Name | 6-chloro-N-[(1-methylsulfanylcyclobutyl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 107268817 |
| Molecular Formula | C10H14ClN3S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 6-chloro-N-[(1-methylsulfanylcyclobutyl)methyl]pyrazin-2-amine |
| SMILES | CSC1(CNc2cncc(Cl)n2)CCC1 |
| InChI | InChI=1S/C10H14ClN3S/c1-15-10(3-2-4-10)7-13-9-6-12-5-8(11)14-9/h5-6H,2-4,7H2,1H3,(H,13,14) |
| InChIKey | FIIIRVKLDNMOEF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |