C11H15BrN2S — CID 107268827
5-bromo-N-[(1-methylsulfanylcyclobutyl)methyl]pyridin-3-amine (PubChem CID 107268827) has the molecular formula C11H15BrN2S and a molecular weight of 287.23 g/mol. Its IUPAC name is 5-bromo-N-[(1-methylsulfanylcyclobutyl)methyl]pyridin-3-amine.
| Compound Name | 5-bromo-N-[(1-methylsulfanylcyclobutyl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 107268827 |
| Molecular Formula | C11H15BrN2S |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 5-bromo-N-[(1-methylsulfanylcyclobutyl)methyl]pyridin-3-amine |
| SMILES | CSC1(CNc2cncc(Br)c2)CCC1 |
| InChI | InChI=1S/C11H15BrN2S/c1-15-11(3-2-4-11)8-14-10-5-9(12)6-13-7-10/h5-7,14H,2-4,8H2,1H3 |
| InChIKey | CMJUXKRKIQOWSX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |