C15H16N4O2 — CID 107269555
4-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]cinnoline-3-carbonitrile (PubChem CID 107269555) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]cinnoline-3-carbonitrile.
| Compound Name | 4-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]cinnoline-3-carbonitrile |
|---|---|
| PubChem CID | 107269555 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-[(3-hydroxy-2-methyloxolan-3-yl)methylamino]cinnoline-3-carbonitrile |
| SMILES | CC1OCCC1(O)CNc1c(C#N)nnc2ccccc12 |
| InChI | InChI=1S/C15H16N4O2/c1-10-15(20,6-7-21-10)9-17-14-11-4-2-3-5-12(11)18-19-13(14)8-16/h2-5,10,20H,6-7,9H2,1H3,(H,17,18) |
| InChIKey | XVWORGCTTNVESP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |