C16H18N4O — CID 115360612
4-[[1-(hydroxymethyl)cyclopentyl]methylamino]cinnoline-3-carbonitrile (PubChem CID 115360612) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 4-[[1-(hydroxymethyl)cyclopentyl]methylamino]cinnoline-3-carbonitrile.
| Compound Name | 4-[[1-(hydroxymethyl)cyclopentyl]methylamino]cinnoline-3-carbonitrile |
|---|---|
| PubChem CID | 115360612 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-[[1-(hydroxymethyl)cyclopentyl]methylamino]cinnoline-3-carbonitrile |
| SMILES | N#Cc1nnc2ccccc2c1NCC1(CO)CCCC1 |
| InChI | InChI=1S/C16H18N4O/c17-9-14-15(12-5-1-2-6-13(12)19-20-14)18-10-16(11-21)7-3-4-8-16/h1-2,5-6,21H,3-4,7-8,10-11H2,(H,18,19) |
| InChIKey | FXPZCDRBAVBLQP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |