C13H26N2O — CID 107270318
5-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)pentan-2-ol (PubChem CID 107270318) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 5-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)pentan-2-ol.
| Compound Name | 5-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)pentan-2-ol |
|---|---|
| PubChem CID | 107270318 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 5-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)pentan-2-ol |
| SMILES | CC(O)CCCNC1CCN2CCCC2C1 |
| InChI | InChI=1S/C13H26N2O/c1-11(16)4-2-7-14-12-6-9-15-8-3-5-13(15)10-12/h11-14,16H,2-10H2,1H3 |
| InChIKey | DHJZECHXPNMWAW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|