C12H25NO2 — CID 107267685
5-[(2,6-dimethyloxan-4-yl)amino]pentan-2-ol (PubChem CID 107267685) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 5-[(2,6-dimethyloxan-4-yl)amino]pentan-2-ol.
| Compound Name | 5-[(2,6-dimethyloxan-4-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 107267685 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 5-[(2,6-dimethyloxan-4-yl)amino]pentan-2-ol |
| SMILES | CC(O)CCCNC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C12H25NO2/c1-9(14)5-4-6-13-12-7-10(2)15-11(3)8-12/h9-14H,4-8H2,1-3H3 |
| InChIKey | DJEYELCQXPHWJW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|