C11H23NO2 — CID 75525282
4-[(2,6-dimethyloxan-4-yl)amino]butan-2-ol (PubChem CID 75525282) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 4-[(2,6-dimethyloxan-4-yl)amino]butan-2-ol.
| Compound Name | 4-[(2,6-dimethyloxan-4-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 75525282 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 4-[(2,6-dimethyloxan-4-yl)amino]butan-2-ol |
| SMILES | CC(O)CCNC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C11H23NO2/c1-8(13)4-5-12-11-6-9(2)14-10(3)7-11/h8-13H,4-7H2,1-3H3 |
| InChIKey | WDHKKXMPXDJQDH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |