C6H5F7 — CID 10727137
1-(difluoromethyl)-1,2,2,3,3-pentafluorocyclopentane (PubChem CID 10727137) has the molecular formula C6H5F7 and a molecular weight of 210.09 g/mol. Its IUPAC name is 1-(difluoromethyl)-1,2,2,3,3-pentafluorocyclopentane.
| Compound Name | 1-(difluoromethyl)-1,2,2,3,3-pentafluorocyclopentane |
|---|---|
| PubChem CID | 10727137 |
| Molecular Formula | C6H5F7 |
| Molecular Weight | 210.09 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 1-(difluoromethyl)-1,2,2,3,3-pentafluorocyclopentane |
| SMILES | FC(F)C1(F)CCC(F)(F)C1(F)F |
| InChI | InChI=1S/C6H5F7/c7-3(8)4(9)1-2-5(10,11)6(4,12)13/h3H,1-2H2 |
| InChIKey | SBMITPKSXWRUHS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.09 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|