C7H8F6 — CID 15507522
1,1-bis(trifluoromethyl)cyclopentane (PubChem CID 15507522) has the molecular formula C7H8F6 and a molecular weight of 206.13 g/mol. Its IUPAC name is 1,1-bis(trifluoromethyl)cyclopentane.
| Compound Name | 1,1-bis(trifluoromethyl)cyclopentane |
|---|---|
| PubChem CID | 15507522 |
| Molecular Formula | C7H8F6 |
| Molecular Weight | 206.13 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 1,1-bis(trifluoromethyl)cyclopentane |
| SMILES | FC(F)(F)C1(C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C7H8F6/c8-6(9,10)5(7(11,12)13)3-1-2-4-5/h1-4H2 |
| InChIKey | UOIMSWITZOPHTP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.13 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |