C12H25NO4S — CID 107271874
1-butoxy-3-(1,1-dioxo-1,4-thiazepan-4-yl)propan-2-ol (PubChem CID 107271874) has the molecular formula C12H25NO4S and a molecular weight of 279.40 g/mol. Its IUPAC name is 1-butoxy-3-(1,1-dioxo-1,4-thiazepan-4-yl)propan-2-ol.
| Compound Name | 1-butoxy-3-(1,1-dioxo-1,4-thiazepan-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 107271874 |
| Molecular Formula | C12H25NO4S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 1-butoxy-3-(1,1-dioxo-1,4-thiazepan-4-yl)propan-2-ol |
| SMILES | CCCCOCC(O)CN1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H25NO4S/c1-2-3-7-17-11-12(14)10-13-5-4-8-18(15,16)9-6-13/h12,14H,2-11H2,1H3 |
| InChIKey | XRCLRAYZJFTWHT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|