C8H17NO3S — CID 126975442
(2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol (PubChem CID 126975442) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is (2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol.
| Compound Name | (2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol |
|---|---|
| PubChem CID | 126975442 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (2S)-1-(1,1-dioxo-1,4-thiazinan-4-yl)butan-2-ol |
| SMILES | CC[C@H](O)CN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C8H17NO3S/c1-2-8(10)7-9-3-5-13(11,12)6-4-9/h8,10H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | BOZBOXDPZJZEGD-QMMMGPOBSA-N |
| XLogP | -0.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |